C15H15N3O3S — CID 110867420
6-amino-3-benzylsulfonyl-5-methyl-1H-benzimidazol-2-one (PubChem CID 110867420) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 6-amino-3-benzylsulfonyl-5-methyl-1H-benzimidazol-2-one.
| Compound Name | 6-amino-3-benzylsulfonyl-5-methyl-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 110867420 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 6-amino-3-benzylsulfonyl-5-methyl-1H-benzimidazol-2-one |
| SMILES | Cc1cc2c(cc1N)[nH]c(=O)n2S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H15N3O3S/c1-10-7-14-13(8-12(10)16)17-15(19)18(14)22(20,21)9-11-5-3-2-4-6-11/h2-8H,9,16H2,1H3,(H,17,19) |
| InChIKey | XJRLBTLQBBCCBQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|