C19H23N4O3S+ — CID 8932842
3-[(4-benzylsulfonylpiperazin-1-ium-1-yl)methyl]-1H-benzimidazol-2-one (PubChem CID 8932842) has the molecular formula C19H23N4O3S+ and a molecular weight of 387.49 g/mol. Its IUPAC name is 3-[(4-benzylsulfonylpiperazin-1-ium-1-yl)methyl]-1H-benzimidazol-2-one.
| Compound Name | 3-[(4-benzylsulfonylpiperazin-1-ium-1-yl)methyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 8932842 |
| Molecular Formula | C19H23N4O3S+ |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 3-[(4-benzylsulfonylpiperazin-1-ium-1-yl)methyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C[NH+]1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N4O3S/c24-19-20-17-8-4-5-9-18(17)23(19)15-21-10-12-22(13-11-21)27(25,26)14-16-6-2-1-3-7-16/h1-9H,10-15H2,(H,20,24)/p+1 |
| InChIKey | PFCLDJIEEIUSHI-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |