C17H21N6O2S2+ — CID 8892674
1-benzylsulfonyl-4-[(5-thiophen-2-yltetrazol-2-yl)methyl]piperazin-4-ium (PubChem CID 8892674) has the molecular formula C17H21N6O2S2+ and a molecular weight of 405.53 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-[(5-thiophen-2-yltetrazol-2-yl)methyl]piperazin-4-ium.
| Compound Name | 1-benzylsulfonyl-4-[(5-thiophen-2-yltetrazol-2-yl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 8892674 |
| Molecular Formula | C17H21N6O2S2+ |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-benzylsulfonyl-4-[(5-thiophen-2-yltetrazol-2-yl)methyl]piperazin-4-ium |
| SMILES | O=S(=O)(Cc1ccccc1)N1CC[NH+](Cn2nnc(-c3cccs3)n2)CC1 |
| InChI | InChI=1S/C17H20N6O2S2/c24-27(25,13-15-5-2-1-3-6-15)22-10-8-21(9-11-22)14-23-19-17(18-20-23)16-7-4-12-26-16/h1-7,12H,8-11,13-14H2/p+1 |
| InChIKey | QIJHCSZYJOBTIU-UHFFFAOYSA-O |
| XLogP | 0.09 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |