About N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide
N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide (PubChem CID 110872189) has the molecular formula C8H11N3O2S2
and a molecular weight of 245.33 g/mol. Its IUPAC name is N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide.
Molecular Properties
| Compound Name | N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide |
| PubChem CID | 110872189 |
| Molecular Formula | C8H11N3O2S2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCc1csc2nccn12 |
| InChI | InChI=1S/C8H11N3O2S2/c1-2-15(12,13)10-5-7-6-14-8-9-3-4-11(7)8/h3-4,6,10H,2,5H2,1H3 |
| InChIKey | NNCYSFSNNYZTLY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide?
The IUPAC name of N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide (CID 110872189) is N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide.
What is the SMILES notation for N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide?
The canonical SMILES for N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide is CCS(=O)(=O)NCc1csc2nccn12.
What is the InChIKey of N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide?
The InChIKey is NNCYSFSNNYZTLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2S2/c1-2-15(12,13)10-5-7-6-14-8-9-3-4-11(7)8/h3-4,6,10H,2,5H2,1H3.
What are the key properties of N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide?
N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide has a molecular weight of 245.33 g/mol, XLogP of 0.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide is sourced from PubChem (CID 110872189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).