C8H11N3O2S2 — CID 110872189
N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide (PubChem CID 110872189) has the molecular formula C8H11N3O2S2 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide.
| Compound Name | N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110872189 |
| Molecular Formula | C8H11N3O2S2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | N-(imidazo[2,1-b][1,3]thiazol-3-ylmethyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCc1csc2nccn12 |
| InChI | InChI=1S/C8H11N3O2S2/c1-2-15(12,13)10-5-7-6-14-8-9-3-4-11(7)8/h3-4,6,10H,2,5H2,1H3 |
| InChIKey | NNCYSFSNNYZTLY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |