C17H18N2O2 — CID 11087246
4-(3,5-dimethoxyanilino)-2,5-dimethylbenzonitrile (PubChem CID 11087246) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-(3,5-dimethoxyanilino)-2,5-dimethylbenzonitrile.
| Compound Name | 4-(3,5-dimethoxyanilino)-2,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 11087246 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-(3,5-dimethoxyanilino)-2,5-dimethylbenzonitrile |
| SMILES | COc1cc(Nc2cc(C)c(C#N)cc2C)cc(OC)c1 |
| InChI | InChI=1S/C17H18N2O2/c1-11-6-17(12(2)5-13(11)10-18)19-14-7-15(20-3)9-16(8-14)21-4/h5-9,19H,1-4H3 |
| InChIKey | LEAUHIGBLOFILH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |