C17H24N4O — CID 110882554
2-[4-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]ethanol (PubChem CID 110882554) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-[4-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 110882554 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-[4-[[5-(4-methylphenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]ethanol |
| SMILES | Cc1ccc(-c2[nH]ncc2CN2CCN(CCO)CC2)cc1 |
| InChI | InChI=1S/C17H24N4O/c1-14-2-4-15(5-3-14)17-16(12-18-19-17)13-21-8-6-20(7-9-21)10-11-22/h2-5,12,22H,6-11,13H2,1H3,(H,18,19) |
| InChIKey | RBERHYXFZFXSIA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |