C17H23ClN4O — CID 98589178
2-[(2R)-4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-1-methylpiperazin-2-yl]ethanol (PubChem CID 98589178) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 2-[(2R)-4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-1-methylpiperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-1-methylpiperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 98589178 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[(2R)-4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-1-methylpiperazin-2-yl]ethanol |
| SMILES | CN1CCN(Cc2cn[nH]c2-c2ccc(Cl)cc2)C[C@H]1CCO |
| InChI | InChI=1S/C17H23ClN4O/c1-21-7-8-22(12-16(21)6-9-23)11-14-10-19-20-17(14)13-2-4-15(18)5-3-13/h2-5,10,16,23H,6-9,11-12H2,1H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | TUEFUBNDDOJIAW-MRXNPFEDSA-N |
| XLogP | 2.23 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |