C18H23NO4 — CID 11088413
[(1R,4R)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] benzoate (PubChem CID 11088413) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is [(1R,4R)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] benzoate.
| Compound Name | [(1R,4R)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] benzoate |
|---|---|
| PubChem CID | 11088413 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [(1R,4R)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] benzoate |
| SMILES | C=C1C[C@@H](NC(=O)OC(C)(C)C)C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23NO4/c1-12-10-14(19-17(21)23-18(2,3)4)11-15(12)22-16(20)13-8-6-5-7-9-13/h5-9,14-15H,1,10-11H2,2-4H3,(H,19,21)/t14-,15-/m1/s1 |
| InChIKey | HPFXFCLZKXPHJQ-HUUCEWRRSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|