C17H14F3NO3 — CID 110884423
N-(3-ethynylphenyl)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanamide (PubChem CID 110884423) has the molecular formula C17H14F3NO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanamide.
| Compound Name | N-(3-ethynylphenyl)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanamide |
|---|---|
| PubChem CID | 110884423 |
| Molecular Formula | C17H14F3NO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(3-ethynylphenyl)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanamide |
| SMILES | C#Cc1cccc(NC(=O)CC(O)(c2ccc(C)o2)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3NO3/c1-3-12-5-4-6-13(9-12)21-15(22)10-16(23,17(18,19)20)14-8-7-11(2)24-14/h1,4-9,23H,10H2,2H3,(H,21,22) |
| InChIKey | OXGZTHKCADJKFE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|