C15H19N5O2 — CID 110886280
(Z)-N-(1-hydroxybutan-2-yl)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enamide (PubChem CID 110886280) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is (Z)-N-(1-hydroxybutan-2-yl)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-(1-hydroxybutan-2-yl)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 110886280 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (Z)-N-(1-hydroxybutan-2-yl)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enamide |
| SMILES | CCC(CO)NC(=O)/C(=C/c1ccccc1)n1nnnc1C |
| InChI | InChI=1S/C15H19N5O2/c1-3-13(10-21)16-15(22)14(20-11(2)17-18-19-20)9-12-7-5-4-6-8-12/h4-9,13,21H,3,10H2,1-2H3,(H,16,22)/b14-9- |
| InChIKey | GCOUBSVRSGUNFY-ZROIWOOFSA-N |
| XLogP | 0.87 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|