C18H36O3Si — CID 11088766
(4S,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethyl-6-methylidenenonan-3-one (PubChem CID 11088766) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (4S,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethyl-6-methylidenenonan-3-one.
| Compound Name | (4S,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethyl-6-methylidenenonan-3-one |
|---|---|
| PubChem CID | 11088766 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (4S,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethyl-6-methylidenenonan-3-one |
| SMILES | C=C([C@@H](O)[C@H](C)C(=O)CC)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-11-15(19)13(4)16(20)14(5)17(12(2)3)21-22(9,10)18(6,7)8/h12-13,16-17,20H,5,11H2,1-4,6-10H3/t13-,16+,17-/m1/s1 |
| InChIKey | AIGGUULLAAKGSZ-XOKHGSTOSA-N |
| XLogP | 4.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|