C30H62O4Si2 — CID 18393300
(3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8,12-pentamethyltridec-12-en-5-one (PubChem CID 18393300) has the molecular formula C30H62O4Si2 and a molecular weight of 542.99 g/mol. Its IUPAC name is (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8,12-pentamethyltridec-12-en-5-one.
| Compound Name | (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8,12-pentamethyltridec-12-en-5-one |
|---|---|
| PubChem CID | 18393300 |
| Molecular Formula | C30H62O4Si2 |
| Molecular Weight | 542.99 g/mol |
| Exact Mass | 542.42 |
| IUPAC Name | (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4,4,6,8,12-pentamethyltridec-12-en-5-one |
| SMILES | C=C(C)CCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H62O4Si2/c1-22(2)18-17-19-23(3)26(34-36(15,16)29(8,9)10)24(4)27(32)30(11,12)25(20-21-31)33-35(13,14)28(5,6)7/h23-26,31H,1,17-21H2,2-16H3/t23-,24+,25-,26-/m0/s1 |
| InChIKey | CMSPSRADPCQYCY-QYOOZWMWSA-N |
| XLogP | 8.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.99 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|