C21H26O4 — CID 11089156
4-[(E)-5-ethoxy-5-(4-hydroxyphenyl)-4-(methoxymethyl)pent-1-enyl]phenol (PubChem CID 11089156) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-[(E)-5-ethoxy-5-(4-hydroxyphenyl)-4-(methoxymethyl)pent-1-enyl]phenol.
| Compound Name | 4-[(E)-5-ethoxy-5-(4-hydroxyphenyl)-4-(methoxymethyl)pent-1-enyl]phenol |
|---|---|
| PubChem CID | 11089156 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-[(E)-5-ethoxy-5-(4-hydroxyphenyl)-4-(methoxymethyl)pent-1-enyl]phenol |
| SMILES | CCOC(c1ccc(O)cc1)C(C/C=C/c1ccc(O)cc1)COC |
| InChI | InChI=1S/C21H26O4/c1-3-25-21(17-9-13-20(23)14-10-17)18(15-24-2)6-4-5-16-7-11-19(22)12-8-16/h4-5,7-14,18,21-23H,3,6,15H2,1-2H3/b5-4+ |
| InChIKey | OYQQRPCWFXPSTN-SNAWJCMRSA-N |
| XLogP | 4.54 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |