C13H22BrNO2S — CID 110892578
1-[(4-bromothiophen-2-yl)methyl-methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol (PubChem CID 110892578) has the molecular formula C13H22BrNO2S and a molecular weight of 336.30 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl-methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl-methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 110892578 |
| Molecular Formula | C13H22BrNO2S |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl-methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
| SMILES | CN(Cc1cc(Br)cs1)CC(O)COC(C)(C)C |
| InChI | InChI=1S/C13H22BrNO2S/c1-13(2,3)17-8-11(16)6-15(4)7-12-5-10(14)9-18-12/h5,9,11,16H,6-8H2,1-4H3 |
| InChIKey | YCBBQDRSQZGTNG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |