C13H23BrN2OS — CID 115475103
1-[(4-bromothiophen-2-yl)methyl-methylamino]-3-(tert-butylamino)propan-2-ol (PubChem CID 115475103) has the molecular formula C13H23BrN2OS and a molecular weight of 335.31 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl-methylamino]-3-(tert-butylamino)propan-2-ol.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl-methylamino]-3-(tert-butylamino)propan-2-ol |
|---|---|
| PubChem CID | 115475103 |
| Molecular Formula | C13H23BrN2OS |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl-methylamino]-3-(tert-butylamino)propan-2-ol |
| SMILES | CN(Cc1cc(Br)cs1)CC(O)CNC(C)(C)C |
| InChI | InChI=1S/C13H23BrN2OS/c1-13(2,3)15-6-11(17)7-16(4)8-12-5-10(14)9-18-12/h5,9,11,15,17H,6-8H2,1-4H3 |
| InChIKey | ZSMGXWUBIGEFPI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |