C10H14N2O3 — CID 110894145
1-(2-hydroxyethyl)-3-[(4-hydroxyphenyl)methyl]urea (PubChem CID 110894145) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[(4-hydroxyphenyl)methyl]urea.
| Compound Name | 1-(2-hydroxyethyl)-3-[(4-hydroxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 110894145 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[(4-hydroxyphenyl)methyl]urea |
| SMILES | O=C(NCCO)NCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H14N2O3/c13-6-5-11-10(15)12-7-8-1-3-9(14)4-2-8/h1-4,13-14H,5-7H2,(H2,11,12,15) |
| InChIKey | KAPVOVCDNSHWDZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |