C18H35N3O2 — CID 110894656
1-[2-(azepan-1-yl)-3-methylbutyl]-3-(4-hydroxycyclohexyl)urea (PubChem CID 110894656) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-3-methylbutyl]-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 110894656 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-3-(4-hydroxycyclohexyl)urea |
| SMILES | CC(C)C(CNC(=O)NC1CCC(O)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C18H35N3O2/c1-14(2)17(21-11-5-3-4-6-12-21)13-19-18(23)20-15-7-9-16(22)10-8-15/h14-17,22H,3-13H2,1-2H3,(H2,19,20,23) |
| InChIKey | YBVCVWYYBQAPHP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |