C19H34F3N3O — CID 55744663
1-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-3-[3-(trifluoromethyl)cyclohexyl]urea (PubChem CID 55744663) has the molecular formula C19H34F3N3O and a molecular weight of 377.50 g/mol. Its IUPAC name is 1-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-3-[3-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-3-[3-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 55744663 |
| Molecular Formula | C19H34F3N3O |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 1-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]-3-[3-(trifluoromethyl)cyclohexyl]urea |
| SMILES | CC1CCN(C(CNC(=O)NC2CCCC(C(F)(F)F)C2)C(C)C)CC1 |
| InChI | InChI=1S/C19H34F3N3O/c1-13(2)17(25-9-7-14(3)8-10-25)12-23-18(26)24-16-6-4-5-15(11-16)19(20,21)22/h13-17H,4-12H2,1-3H3,(H2,23,24,26) |
| InChIKey | HYSDQWIBNPPFNO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |