C14H28N4O3S — CID 95133776
1-(1-methylsulfonylpiperidin-4-yl)-3-[(2R)-2-pyrrolidin-1-ylpropyl]urea (PubChem CID 95133776) has the molecular formula C14H28N4O3S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-(1-methylsulfonylpiperidin-4-yl)-3-[(2R)-2-pyrrolidin-1-ylpropyl]urea.
| Compound Name | 1-(1-methylsulfonylpiperidin-4-yl)-3-[(2R)-2-pyrrolidin-1-ylpropyl]urea |
|---|---|
| PubChem CID | 95133776 |
| Molecular Formula | C14H28N4O3S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1-(1-methylsulfonylpiperidin-4-yl)-3-[(2R)-2-pyrrolidin-1-ylpropyl]urea |
| SMILES | C[C@H](CNC(=O)NC1CCN(S(C)(=O)=O)CC1)N1CCCC1 |
| InChI | InChI=1S/C14H28N4O3S/c1-12(17-7-3-4-8-17)11-15-14(19)16-13-5-9-18(10-6-13)22(2,20)21/h12-13H,3-11H2,1-2H3,(H2,15,16,19)/t12-/m1/s1 |
| InChIKey | SKXOCAXCEJLOAF-GFCCVEGCSA-N |
| XLogP | 0.19 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |