C15H31N3O4S — CID 71931720
1-(3-ethyl-2-hydroxypentyl)-3-(1-ethylsulfonylpiperidin-4-yl)urea (PubChem CID 71931720) has the molecular formula C15H31N3O4S and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-(3-ethyl-2-hydroxypentyl)-3-(1-ethylsulfonylpiperidin-4-yl)urea.
| Compound Name | 1-(3-ethyl-2-hydroxypentyl)-3-(1-ethylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 71931720 |
| Molecular Formula | C15H31N3O4S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-(3-ethyl-2-hydroxypentyl)-3-(1-ethylsulfonylpiperidin-4-yl)urea |
| SMILES | CCC(CC)C(O)CNC(=O)NC1CCN(S(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C15H31N3O4S/c1-4-12(5-2)14(19)11-16-15(20)17-13-7-9-18(10-8-13)23(21,22)6-3/h12-14,19H,4-11H2,1-3H3,(H2,16,17,20) |
| InChIKey | CWDIWMHHIDZHHK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |