C16H24ClN3O4S — CID 36976502
1-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-3-(1-ethylsulfonylpiperidin-4-yl)urea (PubChem CID 36976502) has the molecular formula C16H24ClN3O4S and a molecular weight of 389.91 g/mol. Its IUPAC name is 1-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-3-(1-ethylsulfonylpiperidin-4-yl)urea.
| Compound Name | 1-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-3-(1-ethylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 36976502 |
| Molecular Formula | C16H24ClN3O4S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-3-(1-ethylsulfonylpiperidin-4-yl)urea |
| SMILES | CCS(=O)(=O)N1CCC(NC(=O)NC[C@@H](O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H24ClN3O4S/c1-2-25(23,24)20-9-7-14(8-10-20)19-16(22)18-11-15(21)12-3-5-13(17)6-4-12/h3-6,14-15,21H,2,7-11H2,1H3,(H2,18,19,22)/t15-/m1/s1 |
| InChIKey | LPTOJUPOEILIIL-OAHLLOKOSA-N |
| XLogP | 1.49 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |