C14H30N4O2 — CID 110895658
1-(1-hydroxypropan-2-yl)-3-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]urea (PubChem CID 110895658) has the molecular formula C14H30N4O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-(1-hydroxypropan-2-yl)-3-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]urea.
| Compound Name | 1-(1-hydroxypropan-2-yl)-3-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]urea |
|---|---|
| PubChem CID | 110895658 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1-(1-hydroxypropan-2-yl)-3-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]urea |
| SMILES | CC(CO)NC(=O)NCC(C(C)C)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H30N4O2/c1-11(2)13(18-7-5-17(4)6-8-18)9-15-14(20)16-12(3)10-19/h11-13,19H,5-10H2,1-4H3,(H2,15,16,20) |
| InChIKey | DFNXPZOUCHNWKI-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |