C14H28ClN3O — CID 55204260
4-chloro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]butanamide (PubChem CID 55204260) has the molecular formula C14H28ClN3O and a molecular weight of 289.85 g/mol. Its IUPAC name is 4-chloro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]butanamide.
| Compound Name | 4-chloro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]butanamide |
|---|---|
| PubChem CID | 55204260 |
| Molecular Formula | C14H28ClN3O |
| Molecular Weight | 289.85 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 4-chloro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]butanamide |
| SMILES | CC(C)C(CNC(=O)CCCCl)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H28ClN3O/c1-12(2)13(11-16-14(19)5-4-6-15)18-9-7-17(3)8-10-18/h12-13H,4-11H2,1-3H3,(H,16,19) |
| InChIKey | JPCMDKSVGMRULR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.85 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|