C12H26ClN3O2S — CID 107651672
2-chloro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]ethanesulfonamide (PubChem CID 107651672) has the molecular formula C12H26ClN3O2S and a molecular weight of 311.88 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107651672 |
| Molecular Formula | C12H26ClN3O2S |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-chloro-N-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]ethanesulfonamide |
| SMILES | CC(C)C(CNS(=O)(=O)CCCl)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H26ClN3O2S/c1-11(2)12(10-14-19(17,18)9-4-13)16-7-5-15(3)6-8-16/h11-12,14H,4-10H2,1-3H3 |
| InChIKey | DXDCRUNJLBOEOH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|