C17H36N4O2 — CID 111504437
1-(3-hydroxy-4-methylpentyl)-3-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]urea (PubChem CID 111504437) has the molecular formula C17H36N4O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-(3-hydroxy-4-methylpentyl)-3-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]urea.
| Compound Name | 1-(3-hydroxy-4-methylpentyl)-3-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]urea |
|---|---|
| PubChem CID | 111504437 |
| Molecular Formula | C17H36N4O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | 1-(3-hydroxy-4-methylpentyl)-3-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]urea |
| SMILES | CC(C)C(O)CCNC(=O)NCC(C(C)C)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H36N4O2/c1-13(2)15(21-10-8-20(5)9-11-21)12-19-17(23)18-7-6-16(22)14(3)4/h13-16,22H,6-12H2,1-5H3,(H2,18,19,23) |
| InChIKey | HVHGUGMSFRGPCQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |