C12H16N2O2S — CID 110897941
2-(2-hydroxy-3-propan-2-yloxypropyl)sulfanylpyridine-4-carbonitrile (PubChem CID 110897941) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-(2-hydroxy-3-propan-2-yloxypropyl)sulfanylpyridine-4-carbonitrile.
| Compound Name | 2-(2-hydroxy-3-propan-2-yloxypropyl)sulfanylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 110897941 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-(2-hydroxy-3-propan-2-yloxypropyl)sulfanylpyridine-4-carbonitrile |
| SMILES | CC(C)OCC(O)CSc1cc(C#N)ccn1 |
| InChI | InChI=1S/C12H16N2O2S/c1-9(2)16-7-11(15)8-17-12-5-10(6-13)3-4-14-12/h3-5,9,11,15H,7-8H2,1-2H3 |
| InChIKey | PZMCEHQMIYBVSF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |