C19H23FN2O3 — CID 110901250
3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]-N-(2-methoxyphenyl)butanamide (PubChem CID 110901250) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is 3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]-N-(2-methoxyphenyl)butanamide.
| Compound Name | 3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]-N-(2-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 110901250 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 3-[[2-(2-fluorophenyl)-2-hydroxyethyl]amino]-N-(2-methoxyphenyl)butanamide |
| SMILES | COc1ccccc1NC(=O)CC(C)NCC(O)c1ccccc1F |
| InChI | InChI=1S/C19H23FN2O3/c1-13(21-12-17(23)14-7-3-4-8-15(14)20)11-19(24)22-16-9-5-6-10-18(16)25-2/h3-10,13,17,21,23H,11-12H2,1-2H3,(H,22,24) |
| InChIKey | GAMJDRUITRNVKA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |