C19H32O8 — CID 11090374
3-O,3-O-ditert-butyl 1-O,5-O-dimethyl pentane-1,3,3,5-tetracarboxylate (PubChem CID 11090374) has the molecular formula C19H32O8 and a molecular weight of 388.46 g/mol. Its IUPAC name is 3-O,3-O-ditert-butyl 1-O,5-O-dimethyl pentane-1,3,3,5-tetracarboxylate.
| Compound Name | 3-O,3-O-ditert-butyl 1-O,5-O-dimethyl pentane-1,3,3,5-tetracarboxylate |
|---|---|
| PubChem CID | 11090374 |
| Molecular Formula | C19H32O8 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 3-O,3-O-ditert-butyl 1-O,5-O-dimethyl pentane-1,3,3,5-tetracarboxylate |
| SMILES | COC(=O)CCC(CCC(=O)OC)(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32O8/c1-17(2,3)26-15(22)19(11-9-13(20)24-7,12-10-14(21)25-8)16(23)27-18(4,5)6/h9-12H2,1-8H3 |
| InChIKey | SEYCBGKIKGQDKO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|