C20H25N3O2 — CID 110907686
1-benzyl-1-(2-hydroxyethyl)-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)urea (PubChem CID 110907686) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-benzyl-1-(2-hydroxyethyl)-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)urea.
| Compound Name | 1-benzyl-1-(2-hydroxyethyl)-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)urea |
|---|---|
| PubChem CID | 110907686 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-benzyl-1-(2-hydroxyethyl)-3-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)urea |
| SMILES | CN1CCCc2cc(NC(=O)N(CCO)Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C20H25N3O2/c1-22-11-5-8-17-14-18(9-10-19(17)22)21-20(25)23(12-13-24)15-16-6-3-2-4-7-16/h2-4,6-7,9-10,14,24H,5,8,11-13,15H2,1H3,(H,21,25) |
| InChIKey | VQBJDRNRUNXOFT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|