C24H22N2O2 — CID 112838325
1-benzyl-1-(2-hydroxyethyl)-3-[3-(2-phenylethynyl)phenyl]urea (PubChem CID 112838325) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-benzyl-1-(2-hydroxyethyl)-3-[3-(2-phenylethynyl)phenyl]urea.
| Compound Name | 1-benzyl-1-(2-hydroxyethyl)-3-[3-(2-phenylethynyl)phenyl]urea |
|---|---|
| PubChem CID | 112838325 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-benzyl-1-(2-hydroxyethyl)-3-[3-(2-phenylethynyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C#Cc2ccccc2)c1)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C24H22N2O2/c27-17-16-26(19-22-10-5-2-6-11-22)24(28)25-23-13-7-12-21(18-23)15-14-20-8-3-1-4-9-20/h1-13,18,27H,16-17,19H2,(H,25,28) |
| InChIKey | DSKBAGSOQMCHEJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|