C26H27NO4 — CID 11091031
5,6,7-trimethoxy-N-[(4-methoxyphenyl)methyl]-N-methylphenanthren-9-amine (PubChem CID 11091031) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 5,6,7-trimethoxy-N-[(4-methoxyphenyl)methyl]-N-methylphenanthren-9-amine.
| Compound Name | 5,6,7-trimethoxy-N-[(4-methoxyphenyl)methyl]-N-methylphenanthren-9-amine |
|---|---|
| PubChem CID | 11091031 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 5,6,7-trimethoxy-N-[(4-methoxyphenyl)methyl]-N-methylphenanthren-9-amine |
| SMILES | COc1ccc(CN(C)c2cc3ccccc3c3c(OC)c(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-27(16-17-10-12-19(28-2)13-11-17)22-14-18-8-6-7-9-20(18)24-21(22)15-23(29-3)25(30-4)26(24)31-5/h6-15H,16H2,1-5H3 |
| InChIKey | JOXHHSPEAMQLAE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|