C9H13BrO4S2 — CID 110913023
2-[2-[(3-bromothiophen-2-yl)methylsulfonyl]ethoxy]ethanol (PubChem CID 110913023) has the molecular formula C9H13BrO4S2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-[2-[(3-bromothiophen-2-yl)methylsulfonyl]ethoxy]ethanol.
| Compound Name | 2-[2-[(3-bromothiophen-2-yl)methylsulfonyl]ethoxy]ethanol |
|---|---|
| PubChem CID | 110913023 |
| Molecular Formula | C9H13BrO4S2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | 2-[2-[(3-bromothiophen-2-yl)methylsulfonyl]ethoxy]ethanol |
| SMILES | O=S(=O)(CCOCCO)Cc1sccc1Br |
| InChI | InChI=1S/C9H13BrO4S2/c10-8-1-5-15-9(8)7-16(12,13)6-4-14-3-2-11/h1,5,11H,2-4,6-7H2 |
| InChIKey | NPBRDJDWIRCSHY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|