C12H15NO5S2 — CID 60563039
2-[2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methylsulfonyl]ethoxy]ethanol (PubChem CID 60563039) has the molecular formula C12H15NO5S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methylsulfonyl]ethoxy]ethanol.
| Compound Name | 2-[2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methylsulfonyl]ethoxy]ethanol |
|---|---|
| PubChem CID | 60563039 |
| Molecular Formula | C12H15NO5S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-[2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methylsulfonyl]ethoxy]ethanol |
| SMILES | O=S(=O)(CCOCCO)Cc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C12H15NO5S2/c14-3-4-17-5-7-20(15,16)9-10-8-18-12(13-10)11-2-1-6-19-11/h1-2,6,8,14H,3-5,7,9H2 |
| InChIKey | KTVBMUDENAAZCG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|