C19H25NO3S — CID 110913043
1-[3-(4-methoxyphenyl)pyrrolidin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 110913043) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenyl)pyrrolidin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[3-(4-methoxyphenyl)pyrrolidin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 110913043 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-[3-(4-methoxyphenyl)pyrrolidin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | COc1ccc(C2CCN(CC(O)COCc3cccs3)C2)cc1 |
| InChI | InChI=1S/C19H25NO3S/c1-22-18-6-4-15(5-7-18)16-8-9-20(11-16)12-17(21)13-23-14-19-3-2-10-24-19/h2-7,10,16-17,21H,8-9,11-14H2,1H3 |
| InChIKey | MDLKMISXARYBRR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |