C20H36N2O2S — CID 75453728
1-[4-[3-(diethylamino)propyl]piperidin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 75453728) has the molecular formula C20H36N2O2S and a molecular weight of 368.59 g/mol. Its IUPAC name is 1-[4-[3-(diethylamino)propyl]piperidin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[4-[3-(diethylamino)propyl]piperidin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 75453728 |
| Molecular Formula | C20H36N2O2S |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-[4-[3-(diethylamino)propyl]piperidin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | CCN(CC)CCCC1CCN(CC(O)COCc2cccs2)CC1 |
| InChI | InChI=1S/C20H36N2O2S/c1-3-21(4-2)11-5-7-18-9-12-22(13-10-18)15-19(23)16-24-17-20-8-6-14-25-20/h6,8,14,18-19,23H,3-5,7,9-13,15-17H2,1-2H3 |
| InChIKey | HZFWJNVTLYUCPU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |