C15H29IN4 — CID 110914803
3-methyl-2-N,2-N-bis(prop-2-enyl)-1-N-(1,4,5,6-tetrahydropyrimidin-2-yl)butane-1,2-diamine;hydroiodide (PubChem CID 110914803) has the molecular formula C15H29IN4 and a molecular weight of 392.33 g/mol. Its IUPAC name is 3-methyl-2-N,2-N-bis(prop-2-enyl)-1-N-(1,4,5,6-tetrahydropyrimidin-2-yl)butane-1,2-diamine;hydroiodide.
| Compound Name | 3-methyl-2-N,2-N-bis(prop-2-enyl)-1-N-(1,4,5,6-tetrahydropyrimidin-2-yl)butane-1,2-diamine;hydroiodide |
|---|---|
| PubChem CID | 110914803 |
| Molecular Formula | C15H29IN4 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-methyl-2-N,2-N-bis(prop-2-enyl)-1-N-(1,4,5,6-tetrahydropyrimidin-2-yl)butane-1,2-diamine;hydroiodide |
| SMILES | C=CCN(CC=C)C(CNC1=NCCCN1)C(C)C.I |
| InChI | InChI=1S/C15H28N4.HI/c1-5-10-19(11-6-2)14(13(3)4)12-18-15-16-8-7-9-17-15;/h5-6,13-14H,1-2,7-12H2,3-4H3,(H2,16,17,18);1H |
| InChIKey | BLYRWAXFDFENTG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|