C18H28IN3O2 — CID 110918345
N-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 110918345) has the molecular formula C18H28IN3O2 and a molecular weight of 445.35 g/mol. Its IUPAC name is N-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 110918345 |
| Molecular Formula | C18H28IN3O2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | CCOc1ccc(C2(CNC3=NCCCN3)CCOCC2)cc1.I |
| InChI | InChI=1S/C18H27N3O2.HI/c1-2-23-16-6-4-15(5-7-16)18(8-12-22-13-9-18)14-21-17-19-10-3-11-20-17;/h4-7H,2-3,8-14H2,1H3,(H2,19,20,21);1H |
| InChIKey | SOXQGKZWVVSYBX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|