C16H23FIN3O — CID 119112962
N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 119112962) has the molecular formula C16H23FIN3O and a molecular weight of 419.28 g/mol. Its IUPAC name is N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 119112962 |
| Molecular Formula | C16H23FIN3O |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Fc1ccc(C2(CNC3=NCCCN3)CCOCC2)cc1.I |
| InChI | InChI=1S/C16H22FN3O.HI/c17-14-4-2-13(3-5-14)16(6-10-21-11-7-16)12-20-15-18-8-1-9-19-15;/h2-5H,1,6-12H2,(H2,18,19,20);1H |
| InChIKey | NRFPTQADYYQDAM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|