C25H28N4O6 — CID 11092042
tert-butyl 5-oxido-2-[(2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl)methyl]pyrrolo[3,2-c]pyridin-5-ium-1-carboxylate (PubChem CID 11092042) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is tert-butyl 5-oxido-2-[(2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl)methyl]pyrrolo[3,2-c]pyridin-5-ium-1-carboxylate.
| Compound Name | tert-butyl 5-oxido-2-[(2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl)methyl]pyrrolo[3,2-c]pyridin-5-ium-1-carboxylate |
|---|---|
| PubChem CID | 11092042 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | tert-butyl 5-oxido-2-[(2-oxo-4-phenylmethoxycarbonylpiperazin-1-yl)methyl]pyrrolo[3,2-c]pyridin-5-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(CN2CCN(C(=O)OCc3ccccc3)CC2=O)cc2c[n+]([O-])ccc21 |
| InChI | InChI=1S/C25H28N4O6/c1-25(2,3)35-24(32)29-20(13-19-14-28(33)10-9-21(19)29)15-26-11-12-27(16-22(26)30)23(31)34-17-18-7-5-4-6-8-18/h4-10,13-14H,11-12,15-17H2,1-3H3 |
| InChIKey | OECKMOWZWPNLDG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 108.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|