C18H23N3O3 — CID 110921650
1-[3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 110921650) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 110921650 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | Cc1cc2ncn(CC(O)CN3C(=O)CC(C)(C)C3=O)c2cc1C |
| InChI | InChI=1S/C18H23N3O3/c1-11-5-14-15(6-12(11)2)20(10-19-14)8-13(22)9-21-16(23)7-18(3,4)17(21)24/h5-6,10,13,22H,7-9H2,1-4H3 |
| InChIKey | NYUPQRKAPBUICQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|