C22H24N4O3 — CID 94380779
(5S)-3-[(2S)-3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 94380779) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is (5S)-3-[(2S)-3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(2S)-3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94380779 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (5S)-3-[(2S)-3-(5,6-dimethylbenzimidazol-1-yl)-2-hydroxypropyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1cc2ncn(C[C@H](O)CN3C(=O)N[C@@](C)(c4ccccc4)C3=O)c2cc1C |
| InChI | InChI=1S/C22H24N4O3/c1-14-9-18-19(10-15(14)2)25(13-23-18)11-17(27)12-26-20(28)22(3,24-21(26)29)16-7-5-4-6-8-16/h4-10,13,17,27H,11-12H2,1-3H3,(H,24,29)/t17-,22-/m0/s1 |
| InChIKey | ZCFSHFRHTLRPLK-JTSKRJEESA-N |
| XLogP | 2.48 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|