C16H17ClN2O2 — CID 110923275
1-[[2-(4-chlorophenyl)phenyl]methyl]-3-(2-hydroxyethyl)urea (PubChem CID 110923275) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 1-[[2-(4-chlorophenyl)phenyl]methyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[[2-(4-chlorophenyl)phenyl]methyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110923275 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-[[2-(4-chlorophenyl)phenyl]methyl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)NCc1ccccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O2/c17-14-7-5-12(6-8-14)15-4-2-1-3-13(15)11-19-16(21)18-9-10-20/h1-8,20H,9-11H2,(H2,18,19,21) |
| InChIKey | KHVYKASMSBNMTN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |