C16H16N4O2S — CID 110928260
N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]-6-methylpyridine-3-carboxamide (PubChem CID 110928260) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 110928260 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(-c3cccs3)nn2CCO)cn1 |
| InChI | InChI=1S/C16H16N4O2S/c1-11-4-5-12(10-17-11)16(22)18-15-9-13(14-3-2-8-23-14)19-20(15)6-7-21/h2-5,8-10,21H,6-7H2,1H3,(H,18,22) |
| InChIKey | KUVXPOFCDJYHED-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |