C13H17N3O2S — CID 110928296
N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]butanamide (PubChem CID 110928296) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]butanamide.
| Compound Name | N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]butanamide |
|---|---|
| PubChem CID | 110928296 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]butanamide |
| SMILES | CCCC(=O)Nc1cc(-c2cccs2)nn1CCO |
| InChI | InChI=1S/C13H17N3O2S/c1-2-4-13(18)14-12-9-10(11-5-3-8-19-11)15-16(12)6-7-17/h3,5,8-9,17H,2,4,6-7H2,1H3,(H,14,18) |
| InChIKey | YAPDCKMPOJNGSH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |