C15H13FN4O2S — CID 111456737
3-fluoro-N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]pyridine-4-carboxamide (PubChem CID 111456737) has the molecular formula C15H13FN4O2S and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-fluoro-N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 111456737 |
| Molecular Formula | C15H13FN4O2S |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 3-fluoro-N-[1-(2-hydroxyethyl)-3-thiophen-2-ylpyrazol-5-yl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cc(-c2cccs2)nn1CCO)c1ccncc1F |
| InChI | InChI=1S/C15H13FN4O2S/c16-11-9-17-4-3-10(11)15(22)18-14-8-12(13-2-1-7-23-13)19-20(14)5-6-21/h1-4,7-9,21H,5-6H2,(H,18,22) |
| InChIKey | KKWIMNSGFJGPAF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |