C18H18F3NO2 — CID 110928528
1-(2,6-difluorophenyl)-2-[2-(2-fluorophenyl)morpholin-4-yl]ethanol (PubChem CID 110928528) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-[2-(2-fluorophenyl)morpholin-4-yl]ethanol.
| Compound Name | 1-(2,6-difluorophenyl)-2-[2-(2-fluorophenyl)morpholin-4-yl]ethanol |
|---|---|
| PubChem CID | 110928528 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-[2-(2-fluorophenyl)morpholin-4-yl]ethanol |
| SMILES | OC(CN1CCOC(c2ccccc2F)C1)c1c(F)cccc1F |
| InChI | InChI=1S/C18H18F3NO2/c19-13-5-2-1-4-12(13)17-11-22(8-9-24-17)10-16(23)18-14(20)6-3-7-15(18)21/h1-7,16-17,23H,8-11H2 |
| InChIKey | GNORRWRJZVXKBM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |