C16H20N2O2 — CID 110929258
3-[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]propan-1-ol (PubChem CID 110929258) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]propan-1-ol.
| Compound Name | 3-[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 110929258 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]propan-1-ol |
| SMILES | OCCCNCc1ccccc1OCc1cccnc1 |
| InChI | InChI=1S/C16H20N2O2/c19-10-4-9-18-12-15-6-1-2-7-16(15)20-13-14-5-3-8-17-11-14/h1-3,5-8,11,18-19H,4,9-10,12-13H2 |
| InChIKey | OWGDGUKRKZTOJY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|