C20H26N2O3 — CID 122129096
2-ethyl-2-[[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]methyl]butanoic acid (PubChem CID 122129096) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-ethyl-2-[[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 122129096 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-ethyl-2-[[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNCc1ccccc1OCc1cccnc1)C(=O)O |
| InChI | InChI=1S/C20H26N2O3/c1-3-20(4-2,19(23)24)15-22-13-17-9-5-6-10-18(17)25-14-16-8-7-11-21-12-16/h5-12,22H,3-4,13-15H2,1-2H3,(H,23,24) |
| InChIKey | WNWKRKZGCQAZLD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |