C15H18N2O2 — CID 111421639
2-[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]ethanol (PubChem CID 111421639) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]ethanol.
| Compound Name | 2-[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 111421639 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-[[2-(pyridin-3-ylmethoxy)phenyl]methylamino]ethanol |
| SMILES | OCCNCc1ccccc1OCc1cccnc1 |
| InChI | InChI=1S/C15H18N2O2/c18-9-8-17-11-14-5-1-2-6-15(14)19-12-13-4-3-7-16-10-13/h1-7,10,17-18H,8-9,11-12H2 |
| InChIKey | ICCZAUVATUPHHP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|