C9H21IN4O3S — CID 110930274
2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 110930274) has the molecular formula C9H21IN4O3S and a molecular weight of 392.26 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110930274 |
| Molecular Formula | C9H21IN4O3S |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | COCCN/C(N)=N/CCN1CCCS1(=O)=O.I |
| InChI | InChI=1S/C9H20N4O3S.HI/c1-16-7-4-12-9(10)11-3-6-13-5-2-8-17(13,14)15;/h2-8H2,1H3,(H3,10,11,12);1H |
| InChIKey | QITCBLLCBAYUBI-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|